 Product categoryFriends links |
|
 Click on the image to check the artwork |
|
| product: |
view count: 89CALCIUM CARBONATE |
| unit price: |
Negotiable |
| min amount: |
|
| amount: |
|
| period for delivery: |
Consignment Deadline days |
| Expiry date: |
Long Effective |
| last update: |
2017-07-07 19:34 |
| |
 |
|
CALCIUM CARBONATE
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
471-34-1;13397-25-6;1317-65-3 |
| EC NO: |
207-439-9 |
| Molecular Formula: |
CaCO3
|
| Molecular Weight: |
100.088 |
| Specification: |
|
| InChI: |
InChI=1/CH2O3.Ca.2H/c2-1(3)4;;;/h(H2,2,3,4);;;/p-2/rCH2O3.CaH2/c2-1(3)4;/h(H2,2,3,4);1H2/p-2 |
| Synonyms: |
C.I. 77220;C.I. Pigment White 18;Chalk;Weightily Calcium Carbonate;Calcium Carbonate Light;Calcium Carbonate Heavy;Biological Calcium Carbonate;Oyster Shell Powder;Carbonic acid calcium salt (1:1);Limestone; |
| Molecular Structure: |
 |
|
